About 2-aminobenzonitrile;N-methyl-4-methylsulfonylaniline
2-aminobenzonitrile;N-methyl-4-methylsulfonylaniline (PubChem CID 142115341) has the molecular formula C15H17N3O2S
and a molecular weight of 303.39 g/mol. Its IUPAC name is 2-aminobenzonitrile;N-methyl-4-methylsulfonylaniline.
Molecular Properties
| Compound Name | 2-aminobenzonitrile;N-methyl-4-methylsulfonylaniline |
| PubChem CID | 142115341 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 2-aminobenzonitrile;N-methyl-4-methylsulfonylaniline |
| SMILES | CNc1ccc(S(C)(=O)=O)cc1.N#Cc1ccccc1N |
| InChI | InChI=1S/C8H11NO2S.C7H6N2/c1-9-7-3-5-8(6-4-7)12(2,10)11;8-5-6-3-1-2-4-7(6)9/h3-6,9H,1-2H3;1-4H,9H2 |
| InChIKey | IHHFPWBYJJMVMX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-aminobenzonitrile;N-methyl-4-methylsulfonylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobenzonitrile;N-methyl-4-methylsulfonylaniline?
The IUPAC name of 2-aminobenzonitrile;N-methyl-4-methylsulfonylaniline (CID 142115341) is 2-aminobenzonitrile;N-methyl-4-methylsulfonylaniline.
What is the SMILES notation for 2-aminobenzonitrile;N-methyl-4-methylsulfonylaniline?
The canonical SMILES for 2-aminobenzonitrile;N-methyl-4-methylsulfonylaniline is CNc1ccc(S(C)(=O)=O)cc1.N#Cc1ccccc1N.
What is the InChIKey of 2-aminobenzonitrile;N-methyl-4-methylsulfonylaniline?
The InChIKey is IHHFPWBYJJMVMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2S.C7H6N2/c1-9-7-3-5-8(6-4-7)12(2,10)11;8-5-6-3-1-2-4-7(6)9/h3-6,9H,1-2H3;1-4H,9H2.
What are the key properties of 2-aminobenzonitrile;N-methyl-4-methylsulfonylaniline?
2-aminobenzonitrile;N-methyl-4-methylsulfonylaniline has a molecular weight of 303.39 g/mol, XLogP of 2.27, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobenzonitrile;N-methyl-4-methylsulfonylaniline is sourced from PubChem (CID 142115341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).