About 2-aminobenzonitrile;2-amino-5-bromobenzonitrile
2-aminobenzonitrile;2-amino-5-bromobenzonitrile (PubChem CID 159268277) has the molecular formula C14H11BrN4
and a molecular weight of 315.17 g/mol. Its IUPAC name is 2-aminobenzonitrile;2-amino-5-bromobenzonitrile.
Molecular Properties
| Compound Name | 2-aminobenzonitrile;2-amino-5-bromobenzonitrile |
| PubChem CID | 159268277 |
| Molecular Formula | C14H11BrN4 |
| Molecular Weight | 315.17 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 2-aminobenzonitrile;2-amino-5-bromobenzonitrile |
| SMILES | N#Cc1cc(Br)ccc1N.N#Cc1ccccc1N |
| InChI | InChI=1S/C7H5BrN2.C7H6N2/c8-6-1-2-7(10)5(3-6)4-9;8-5-6-3-1-2-4-7(6)9/h1-3H,10H2;1-4H,9H2 |
| InChIKey | KXJNVMBKIVHEEV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.17 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-aminobenzonitrile;2-amino-5-bromobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobenzonitrile;2-amino-5-bromobenzonitrile?
The IUPAC name of 2-aminobenzonitrile;2-amino-5-bromobenzonitrile (CID 159268277) is 2-aminobenzonitrile;2-amino-5-bromobenzonitrile.
What is the SMILES notation for 2-aminobenzonitrile;2-amino-5-bromobenzonitrile?
The canonical SMILES for 2-aminobenzonitrile;2-amino-5-bromobenzonitrile is N#Cc1cc(Br)ccc1N.N#Cc1ccccc1N.
What is the InChIKey of 2-aminobenzonitrile;2-amino-5-bromobenzonitrile?
The InChIKey is KXJNVMBKIVHEEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrN2.C7H6N2/c8-6-1-2-7(10)5(3-6)4-9;8-5-6-3-1-2-4-7(6)9/h1-3H,10H2;1-4H,9H2.
What are the key properties of 2-aminobenzonitrile;2-amino-5-bromobenzonitrile?
2-aminobenzonitrile;2-amino-5-bromobenzonitrile has a molecular weight of 315.17 g/mol, XLogP of 3.04, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobenzonitrile;2-amino-5-bromobenzonitrile is sourced from PubChem (CID 159268277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).