About but-1-en-2-ylbenzene;prop-2-enenitrile
but-1-en-2-ylbenzene;prop-2-enenitrile (PubChem CID 160693211) has the molecular formula C13H15N
and a molecular weight of 185.27 g/mol. Its IUPAC name is but-1-en-2-ylbenzene;prop-2-enenitrile.
Molecular Properties
| Compound Name | but-1-en-2-ylbenzene;prop-2-enenitrile |
| PubChem CID | 160693211 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | but-1-en-2-ylbenzene;prop-2-enenitrile |
| SMILES | C=C(CC)c1ccccc1.C=CC#N |
| InChI | InChI=1S/C10H12.C3H3N/c1-3-9(2)10-7-5-4-6-8-10;1-2-3-4/h4-8H,2-3H2,1H3;2H,1H2 |
| InChIKey | RPRDAYBNBJOLKM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze but-1-en-2-ylbenzene;prop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-en-2-ylbenzene;prop-2-enenitrile?
The IUPAC name of but-1-en-2-ylbenzene;prop-2-enenitrile (CID 160693211) is but-1-en-2-ylbenzene;prop-2-enenitrile.
What is the SMILES notation for but-1-en-2-ylbenzene;prop-2-enenitrile?
The canonical SMILES for but-1-en-2-ylbenzene;prop-2-enenitrile is C=C(CC)c1ccccc1.C=CC#N.
What is the InChIKey of but-1-en-2-ylbenzene;prop-2-enenitrile?
The InChIKey is RPRDAYBNBJOLKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12.C3H3N/c1-3-9(2)10-7-5-4-6-8-10;1-2-3-4/h4-8H,2-3H2,1H3;2H,1H2.
What are the key properties of but-1-en-2-ylbenzene;prop-2-enenitrile?
but-1-en-2-ylbenzene;prop-2-enenitrile has a molecular weight of 185.27 g/mol, XLogP of 3.81, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-en-2-ylbenzene;prop-2-enenitrile is sourced from PubChem (CID 160693211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).