C14H18 — CID 19692093
1,3-bis(but-1-en-2-yl)benzene (PubChem CID 19692093) has the molecular formula C14H18 and a molecular weight of 186.30 g/mol. Its IUPAC name is 1,3-bis(but-1-en-2-yl)benzene.
| Compound Name | 1,3-bis(but-1-en-2-yl)benzene |
|---|---|
| PubChem CID | 19692093 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 1,3-bis(but-1-en-2-yl)benzene |
| SMILES | C=C(CC)c1cccc(C(=C)CC)c1 |
| InChI | InChI=1S/C14H18/c1-5-11(3)13-8-7-9-14(10-13)12(4)6-2/h7-10H,3-6H2,1-2H3 |
| InChIKey | MCJYURJTWFAFNL-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |