About but-1-en-2-ylbenzene;prop-1-enylbenzene
but-1-en-2-ylbenzene;prop-1-enylbenzene (PubChem CID 173014652) has the molecular formula C19H22
and a molecular weight of 250.38 g/mol. Its IUPAC name is but-1-en-2-ylbenzene;prop-1-enylbenzene.
Molecular Properties
| Compound Name | but-1-en-2-ylbenzene;prop-1-enylbenzene |
| PubChem CID | 173014652 |
| Molecular Formula | C19H22 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | but-1-en-2-ylbenzene;prop-1-enylbenzene |
| SMILES | C=C(CC)c1ccccc1.CC=Cc1ccccc1 |
| InChI | InChI=1S/C10H12.C9H10/c1-3-9(2)10-7-5-4-6-8-10;1-2-6-9-7-4-3-5-8-9/h4-8H,2-3H2,1H3;2-8H,1H3 |
| InChIKey | ZZGMDAJVIAUAPO-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze but-1-en-2-ylbenzene;prop-1-enylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-en-2-ylbenzene;prop-1-enylbenzene?
The IUPAC name of but-1-en-2-ylbenzene;prop-1-enylbenzene (CID 173014652) is but-1-en-2-ylbenzene;prop-1-enylbenzene.
What is the SMILES notation for but-1-en-2-ylbenzene;prop-1-enylbenzene?
The canonical SMILES for but-1-en-2-ylbenzene;prop-1-enylbenzene is C=C(CC)c1ccccc1.CC=Cc1ccccc1.
What is the InChIKey of but-1-en-2-ylbenzene;prop-1-enylbenzene?
The InChIKey is ZZGMDAJVIAUAPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12.C9H10/c1-3-9(2)10-7-5-4-6-8-10;1-2-6-9-7-4-3-5-8-9/h4-8H,2-3H2,1H3;2-8H,1H3.
What are the key properties of but-1-en-2-ylbenzene;prop-1-enylbenzene?
but-1-en-2-ylbenzene;prop-1-enylbenzene has a molecular weight of 250.38 g/mol, XLogP of 5.83, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-en-2-ylbenzene;prop-1-enylbenzene is sourced from PubChem (CID 173014652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).