C20H22 — CID 57250345
(1-ethyl-5-phenylhexa-1,5-dienyl)benzene (PubChem CID 57250345) has the molecular formula C20H22 and a molecular weight of 262.40 g/mol. Its IUPAC name is (1-ethyl-5-phenylhexa-1,5-dienyl)benzene.
| Compound Name | (1-ethyl-5-phenylhexa-1,5-dienyl)benzene |
|---|---|
| PubChem CID | 57250345 |
| Molecular Formula | C20H22 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | (1-ethyl-5-phenylhexa-1,5-dienyl)benzene |
| SMILES | C=C(CCC=C(CC)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H22/c1-3-18(20-14-8-5-9-15-20)16-10-11-17(2)19-12-6-4-7-13-19/h4-9,12-16H,2-3,10-11H2,1H3 |
| InChIKey | XRPAJMQJYJHGOX-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |