About pent-1-en-2-ylbenzene
pent-1-en-2-ylbenzene (PubChem CID 521761) has the molecular formula C11H14
and a molecular weight of 146.23 g/mol. Its IUPAC name is pent-1-en-2-ylbenzene.
Molecular Properties
| Compound Name | pent-1-en-2-ylbenzene |
| PubChem CID | 521761 |
| Molecular Formula | C11H14 |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | pent-1-en-2-ylbenzene |
| SMILES | C=C(CCC)c1ccccc1 |
| InChI | InChI=1S/C11H14/c1-3-7-10(2)11-8-5-4-6-9-11/h4-6,8-9H,2-3,7H2,1H3 |
| InChIKey | ANGVCCXFJKHNDS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze pent-1-en-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pent-1-en-2-ylbenzene?
The IUPAC name of pent-1-en-2-ylbenzene (CID 521761) is pent-1-en-2-ylbenzene.
What is the SMILES notation for pent-1-en-2-ylbenzene?
The canonical SMILES for pent-1-en-2-ylbenzene is C=C(CCC)c1ccccc1.
What is the InChIKey of pent-1-en-2-ylbenzene?
The InChIKey is ANGVCCXFJKHNDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14/c1-3-7-10(2)11-8-5-4-6-9-11/h4-6,8-9H,2-3,7H2,1H3.
What are the key properties of pent-1-en-2-ylbenzene?
pent-1-en-2-ylbenzene has a molecular weight of 146.23 g/mol, XLogP of 3.50, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for pent-1-en-2-ylbenzene is sourced from PubChem (CID 521761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).