C11H12O2 — CID 53475284
1-phenylpentane-1,2-di(18O2)one (PubChem CID 53475284) has the molecular formula C11H12O2 and a molecular weight of 180.22 g/mol. Its IUPAC name is 1-phenylpentane-1,2-di(18O2)one.
| Compound Name | 1-phenylpentane-1,2-di(18O2)one |
|---|---|
| PubChem CID | 53475284 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 180.22 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 1-phenylpentane-1,2-di(18O2)one |
| SMILES | CCCC(=[18O])C(=[18O])c1ccccc1 |
| InChI | InChI=1S/C11H12O2/c1-2-6-10(12)11(13)9-7-4-3-5-8-9/h3-5,7-8H,2,6H2,1H3/i12+2,13+2 |
| InChIKey | PPUJONYIVOFJLM-SURNXMRXSA-N |
| XLogP | 2.24 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.22 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|