C14H10O2 — CID 101209635
1,2-diphenylethane-1,2-di(18O2)one (PubChem CID 101209635) has the molecular formula C14H10O2 and a molecular weight of 214.23 g/mol. Its IUPAC name is 1,2-diphenylethane-1,2-di(18O2)one.
| Compound Name | 1,2-diphenylethane-1,2-di(18O2)one |
|---|---|
| PubChem CID | 101209635 |
| Molecular Formula | C14H10O2 |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 1,2-diphenylethane-1,2-di(18O2)one |
| SMILES | [18O]=C(C(=[18O])c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H10O2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10H/i15+2,16+2 |
| InChIKey | WURBFLDFSFBTLW-IUWMYWAXSA-N |
| XLogP | 2.75 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|