C17H19NO2 — CID 88527127
2-methylidenebutanoic acid;5-phenylhexa-2,4-dienenitrile (PubChem CID 88527127) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is 2-methylidenebutanoic acid;5-phenylhexa-2,4-dienenitrile.
| Compound Name | 2-methylidenebutanoic acid;5-phenylhexa-2,4-dienenitrile |
|---|---|
| PubChem CID | 88527127 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-methylidenebutanoic acid;5-phenylhexa-2,4-dienenitrile |
| SMILES | C=C(CC)C(=O)O.CC(=CC=CC#N)c1ccccc1 |
| InChI | InChI=1S/C12H11N.C5H8O2/c1-11(7-5-6-10-13)12-8-3-2-4-9-12;1-3-4(2)5(6)7/h2-9H,1H3;2-3H2,1H3,(H,6,7) |
| InChIKey | YAEBIQFJIQYCIP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|