About 5-ethylhepta-2,4-dien-2-ylbenzene
5-ethylhepta-2,4-dien-2-ylbenzene (PubChem CID 91182032) has the molecular formula C15H20
and a molecular weight of 200.33 g/mol. Its IUPAC name is 5-ethylhepta-2,4-dien-2-ylbenzene.
Molecular Properties
| Compound Name | 5-ethylhepta-2,4-dien-2-ylbenzene |
| PubChem CID | 91182032 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 5-ethylhepta-2,4-dien-2-ylbenzene |
| SMILES | CCC(=CC=C(C)c1ccccc1)CC |
| InChI | InChI=1S/C15H20/c1-4-14(5-2)12-11-13(3)15-9-7-6-8-10-15/h6-12H,4-5H2,1-3H3 |
| InChIKey | MATFJBNBAUQMFC-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-ethylhepta-2,4-dien-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethylhepta-2,4-dien-2-ylbenzene?
The IUPAC name of 5-ethylhepta-2,4-dien-2-ylbenzene (CID 91182032) is 5-ethylhepta-2,4-dien-2-ylbenzene.
What is the SMILES notation for 5-ethylhepta-2,4-dien-2-ylbenzene?
The canonical SMILES for 5-ethylhepta-2,4-dien-2-ylbenzene is CCC(=CC=C(C)c1ccccc1)CC.
What is the InChIKey of 5-ethylhepta-2,4-dien-2-ylbenzene?
The InChIKey is MATFJBNBAUQMFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20/c1-4-14(5-2)12-11-13(3)15-9-7-6-8-10-15/h6-12H,4-5H2,1-3H3.
What are the key properties of 5-ethylhepta-2,4-dien-2-ylbenzene?
5-ethylhepta-2,4-dien-2-ylbenzene has a molecular weight of 200.33 g/mol, XLogP of 4.84, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethylhepta-2,4-dien-2-ylbenzene is sourced from PubChem (CID 91182032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).