C32H33NO4 — CID 88506335
5-cyano-3-ethyl-2-(2-phenylethenyl)penta-2,4-dienoic acid;hexa-1,3,5-trienylbenzene;2-methylprop-2-enoic acid (PubChem CID 88506335) has the molecular formula C32H33NO4 and a molecular weight of 495.62 g/mol. Its IUPAC name is 5-cyano-3-ethyl-2-(2-phenylethenyl)penta-2,4-dienoic acid;hexa-1,3,5-trienylbenzene;2-methylprop-2-enoic acid.
| Compound Name | 5-cyano-3-ethyl-2-(2-phenylethenyl)penta-2,4-dienoic acid;hexa-1,3,5-trienylbenzene;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 88506335 |
| Molecular Formula | C32H33NO4 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | 5-cyano-3-ethyl-2-(2-phenylethenyl)penta-2,4-dienoic acid;hexa-1,3,5-trienylbenzene;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.C=CC=CC=Cc1ccccc1.CCC(C=CC#N)=C(C=Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H15NO2.C12H12.C4H6O2/c1-2-14(9-6-12-17)15(16(18)19)11-10-13-7-4-3-5-8-13;1-2-3-4-6-9-12-10-7-5-8-11-12;1-3(2)4(5)6/h3-11H,2H2,1H3,(H,18,19);2-11H,1H2;1H2,2H3,(H,5,6) |
| InChIKey | MSCNQSGHPCVLDR-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|