C19H21NO2 — CID 159572196
buta-1,3-diene;methyl prop-2-enoate;5-phenylpenta-2,4-dienenitrile (PubChem CID 159572196) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is buta-1,3-diene;methyl prop-2-enoate;5-phenylpenta-2,4-dienenitrile.
| Compound Name | buta-1,3-diene;methyl prop-2-enoate;5-phenylpenta-2,4-dienenitrile |
|---|---|
| PubChem CID | 159572196 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | buta-1,3-diene;methyl prop-2-enoate;5-phenylpenta-2,4-dienenitrile |
| SMILES | C=CC(=O)OC.C=CC=C.N#CC=CC=Cc1ccccc1 |
| InChI | InChI=1S/C11H9N.C4H6O2.C4H6/c12-10-6-2-5-9-11-7-3-1-4-8-11;1-3-4(5)6-2;1-3-4-2/h1-9H;3H,1H2,2H3;3-4H,1-2H2 |
| InChIKey | MHYPADQRQYQDIH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|