C18H15NO2 — CID 87133982
2-(2-cyanoethenyl)-3-(2-phenylethenyl)hepta-2,4,6-trienoic acid (PubChem CID 87133982) has the molecular formula C18H15NO2 and a molecular weight of 277.32 g/mol. Its IUPAC name is 2-(2-cyanoethenyl)-3-(2-phenylethenyl)hepta-2,4,6-trienoic acid.
| Compound Name | 2-(2-cyanoethenyl)-3-(2-phenylethenyl)hepta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 87133982 |
| Molecular Formula | C18H15NO2 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 2-(2-cyanoethenyl)-3-(2-phenylethenyl)hepta-2,4,6-trienoic acid |
| SMILES | C=CC=CC(C=Cc1ccccc1)=C(C=CC#N)C(=O)O |
| InChI | InChI=1S/C18H15NO2/c1-2-3-10-16(17(18(20)21)11-7-14-19)13-12-15-8-5-4-6-9-15/h2-13H,1H2,(H,20,21) |
| InChIKey | JSYJSRCAQHGOTD-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|