C20H19NO2 — CID 88800500
2-(4-cyanobut-3-en-2-yl)-4-(2-phenylethenyl)hepta-2,4,6-trienoic acid (PubChem CID 88800500) has the molecular formula C20H19NO2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 2-(4-cyanobut-3-en-2-yl)-4-(2-phenylethenyl)hepta-2,4,6-trienoic acid.
| Compound Name | 2-(4-cyanobut-3-en-2-yl)-4-(2-phenylethenyl)hepta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 88800500 |
| Molecular Formula | C20H19NO2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 2-(4-cyanobut-3-en-2-yl)-4-(2-phenylethenyl)hepta-2,4,6-trienoic acid |
| SMILES | C=CC=C(C=Cc1ccccc1)C=C(C(=O)O)C(C)C=CC#N |
| InChI | InChI=1S/C20H19NO2/c1-3-8-18(13-12-17-10-5-4-6-11-17)15-19(20(22)23)16(2)9-7-14-21/h3-13,15-16H,1H2,2H3,(H,22,23) |
| InChIKey | VJFXHXFFDSSEIL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|