C18H23NO — CID 88709984
(6S,7S)-6-amino-7-methyl-4-(2-phenylethenyl)nona-1,3-dien-5-one (PubChem CID 88709984) has the molecular formula C18H23NO and a molecular weight of 269.39 g/mol. Its IUPAC name is (6S,7S)-6-amino-7-methyl-4-(2-phenylethenyl)nona-1,3-dien-5-one.
| Compound Name | (6S,7S)-6-amino-7-methyl-4-(2-phenylethenyl)nona-1,3-dien-5-one |
|---|---|
| PubChem CID | 88709984 |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | (6S,7S)-6-amino-7-methyl-4-(2-phenylethenyl)nona-1,3-dien-5-one |
| SMILES | C=CC=C(C=Cc1ccccc1)C(=O)[C@@H](N)[C@@H](C)CC |
| InChI | InChI=1S/C18H23NO/c1-4-9-16(18(20)17(19)14(3)5-2)13-12-15-10-7-6-8-11-15/h4,6-14,17H,1,5,19H2,2-3H3/t14-,17-/m0/s1 |
| InChIKey | OPPNVSNXUPSVQU-YOEHRIQHSA-N |
| XLogP | 3.75 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|