C19H15NO3 — CID 87552533
furan-2,5-dione;3-(2-phenylethenyl)hepta-2,4,6-trienenitrile (PubChem CID 87552533) has the molecular formula C19H15NO3 and a molecular weight of 305.33 g/mol. Its IUPAC name is furan-2,5-dione;3-(2-phenylethenyl)hepta-2,4,6-trienenitrile.
| Compound Name | furan-2,5-dione;3-(2-phenylethenyl)hepta-2,4,6-trienenitrile |
|---|---|
| PubChem CID | 87552533 |
| Molecular Formula | C19H15NO3 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | furan-2,5-dione;3-(2-phenylethenyl)hepta-2,4,6-trienenitrile |
| SMILES | C=CC=CC(C=Cc1ccccc1)=CC#N.O=C1C=CC(=O)O1 |
| InChI | InChI=1S/C15H13N.C4H2O3/c1-2-3-7-15(12-13-16)11-10-14-8-5-4-6-9-14;5-3-1-2-4(6)7-3/h2-12H,1H2;1-2H |
| InChIKey | YGUKLHMOSMLLEL-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|