C17H16F3NO — CID 163899918
(E)-3-phenyl-N-[(2Z,4Z)-1,1,1-trifluoro-2-methylhepta-2,4,6-trien-3-yl]prop-2-enamide (PubChem CID 163899918) has the molecular formula C17H16F3NO and a molecular weight of 307.32 g/mol. Its IUPAC name is (E)-3-phenyl-N-[(2Z,4Z)-1,1,1-trifluoro-2-methylhepta-2,4,6-trien-3-yl]prop-2-enamide.
| Compound Name | (E)-3-phenyl-N-[(2Z,4Z)-1,1,1-trifluoro-2-methylhepta-2,4,6-trien-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 163899918 |
| Molecular Formula | C17H16F3NO |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | (E)-3-phenyl-N-[(2Z,4Z)-1,1,1-trifluoro-2-methylhepta-2,4,6-trien-3-yl]prop-2-enamide |
| SMILES | C=C/C=C\C(NC(=O)/C=C/c1ccccc1)=C(/C)C(F)(F)F |
| InChI | InChI=1S/C17H16F3NO/c1-3-4-10-15(13(2)17(18,19)20)21-16(22)12-11-14-8-6-5-7-9-14/h3-12H,1H2,2H3,(H,21,22)/b10-4-,12-11+,15-13- |
| InChIKey | QIXDRBMJSWRACL-NKVSKQOUSA-N |
| XLogP | 4.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|