C15H16 — CID 143083537
[(1E,3E,5Z)-3-methylocta-1,3,5,7-tetraenyl]benzene (PubChem CID 143083537) has the molecular formula C15H16 and a molecular weight of 196.29 g/mol. Its IUPAC name is [(1E,3E,5Z)-3-methylocta-1,3,5,7-tetraenyl]benzene.
| Compound Name | [(1E,3E,5Z)-3-methylocta-1,3,5,7-tetraenyl]benzene |
|---|---|
| PubChem CID | 143083537 |
| Molecular Formula | C15H16 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | [(1E,3E,5Z)-3-methylocta-1,3,5,7-tetraenyl]benzene |
| SMILES | C=C/C=C\C=C(C)\C=C\c1ccccc1 |
| InChI | InChI=1S/C15H16/c1-3-4-6-9-14(2)12-13-15-10-7-5-8-11-15/h3-13H,1H2,2H3/b6-4-,13-12+,14-9+ |
| InChIKey | YLYYTZGEYHLKFB-HOAPCKKBSA-N |
| XLogP | 4.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|