C12H15N — CID 166740915
(1Z,3Z)-N,2-dimethyl-4-phenylbuta-1,3-dien-1-amine (PubChem CID 166740915) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is (1Z,3Z)-N,2-dimethyl-4-phenylbuta-1,3-dien-1-amine.
| Compound Name | (1Z,3Z)-N,2-dimethyl-4-phenylbuta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 166740915 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | (1Z,3Z)-N,2-dimethyl-4-phenylbuta-1,3-dien-1-amine |
| SMILES | CN/C=C(C)\C=C/c1ccccc1 |
| InChI | InChI=1S/C12H15N/c1-11(10-13-2)8-9-12-6-4-3-5-7-12/h3-10,13H,1-2H3/b9-8-,11-10- |
| InChIKey | PTGCZGAFGQGWLH-XESWYYRISA-N |
| XLogP | 2.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|