C28H26 — CID 56654891
1,2-bis[(1E,3Z)-3-methyl-4-phenylbuta-1,3-dienyl]benzene (PubChem CID 56654891) has the molecular formula C28H26 and a molecular weight of 362.52 g/mol. Its IUPAC name is 1,2-bis[(1E,3Z)-3-methyl-4-phenylbuta-1,3-dienyl]benzene.
| Compound Name | 1,2-bis[(1E,3Z)-3-methyl-4-phenylbuta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 56654891 |
| Molecular Formula | C28H26 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 1,2-bis[(1E,3Z)-3-methyl-4-phenylbuta-1,3-dienyl]benzene |
| SMILES | CC(=C/c1ccccc1)/C=C/c1ccccc1/C=C/C(C)=C\c1ccccc1 |
| InChI | InChI=1S/C28H26/c1-23(21-25-11-5-3-6-12-25)17-19-27-15-9-10-16-28(27)20-18-24(2)22-26-13-7-4-8-14-26/h3-22H,1-2H3/b19-17+,20-18+,23-21-,24-22- |
| InChIKey | LJPIRNIABQMGQF-DGYLJVCESA-N |
| XLogP | 7.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|