C15H20 — CID 15953217
[(1E,3E)-2-methylocta-1,3-dienyl]benzene (PubChem CID 15953217) has the molecular formula C15H20 and a molecular weight of 200.33 g/mol. Its IUPAC name is [(1E,3E)-2-methylocta-1,3-dienyl]benzene.
| Compound Name | [(1E,3E)-2-methylocta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 15953217 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | [(1E,3E)-2-methylocta-1,3-dienyl]benzene |
| SMILES | CCCC/C=C/C(C)=C/c1ccccc1 |
| InChI | InChI=1S/C15H20/c1-3-4-5-7-10-14(2)13-15-11-8-6-9-12-15/h6-13H,3-5H2,1-2H3/b10-7+,14-13+ |
| InChIKey | URZWVYNZPPUCRB-CDITWBNYSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|