C10H19N — CID 138648930
(1Z,3E)-N,2-dimethylocta-1,3-dien-1-amine (PubChem CID 138648930) has the molecular formula C10H19N and a molecular weight of 153.27 g/mol. Its IUPAC name is (1Z,3E)-N,2-dimethylocta-1,3-dien-1-amine.
| Compound Name | (1Z,3E)-N,2-dimethylocta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 138648930 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | (1Z,3E)-N,2-dimethylocta-1,3-dien-1-amine |
| SMILES | CCCC/C=C/C(C)=C\NC |
| InChI | InChI=1S/C10H19N/c1-4-5-6-7-8-10(2)9-11-3/h7-9,11H,4-6H2,1-3H3/b8-7+,10-9- |
| InChIKey | GZMLXRVMTIPNJG-GOJKSUSPSA-N |
| XLogP | 2.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|