C15H25NO — CID 143367342
(6E,7E)-6-(methylaminomethylidene)trideca-7,12-dien-5-one (PubChem CID 143367342) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is (6E,7E)-6-(methylaminomethylidene)trideca-7,12-dien-5-one.
| Compound Name | (6E,7E)-6-(methylaminomethylidene)trideca-7,12-dien-5-one |
|---|---|
| PubChem CID | 143367342 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | (6E,7E)-6-(methylaminomethylidene)trideca-7,12-dien-5-one |
| SMILES | C=CCCC/C=C/C(=C\NC)C(=O)CCCC |
| InChI | InChI=1S/C15H25NO/c1-4-6-8-9-10-11-14(13-16-3)15(17)12-7-5-2/h4,10-11,13,16H,1,5-9,12H2,2-3H3/b11-10+,14-13+ |
| InChIKey | YIJLFTOBUATXIS-IWCZYTNJSA-N |
| XLogP | 3.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|