About tetradeca-6,8,13-trien-5-one
tetradeca-6,8,13-trien-5-one (PubChem CID 141346589) has the molecular formula C14H22O
and a molecular weight of 206.33 g/mol. Its IUPAC name is tetradeca-6,8,13-trien-5-one.
Molecular Properties
| Compound Name | tetradeca-6,8,13-trien-5-one |
| PubChem CID | 141346589 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | tetradeca-6,8,13-trien-5-one |
| SMILES | C=CCCCC=CC=CC(=O)CCCC |
| InChI | InChI=1S/C14H22O/c1-3-5-7-8-9-10-11-13-14(15)12-6-4-2/h3,9-11,13H,1,4-8,12H2,2H3 |
| InChIKey | GMATZHVTLXJGJC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze tetradeca-6,8,13-trien-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetradeca-6,8,13-trien-5-one?
The IUPAC name of tetradeca-6,8,13-trien-5-one (CID 141346589) is tetradeca-6,8,13-trien-5-one.
What is the SMILES notation for tetradeca-6,8,13-trien-5-one?
The canonical SMILES for tetradeca-6,8,13-trien-5-one is C=CCCCC=CC=CC(=O)CCCC.
What is the InChIKey of tetradeca-6,8,13-trien-5-one?
The InChIKey is GMATZHVTLXJGJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O/c1-3-5-7-8-9-10-11-13-14(15)12-6-4-2/h3,9-11,13H,1,4-8,12H2,2H3.
What are the key properties of tetradeca-6,8,13-trien-5-one?
tetradeca-6,8,13-trien-5-one has a molecular weight of 206.33 g/mol, XLogP of 4.21, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tetradeca-6,8,13-trien-5-one is sourced from PubChem (CID 141346589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).