C18H26O — CID 20847728
(4E,6E,8E,10E)-octadeca-1,4,6,8,10-pentaen-3-one (PubChem CID 20847728) has the molecular formula C18H26O and a molecular weight of 258.41 g/mol. Its IUPAC name is (4E,6E,8E,10E)-octadeca-1,4,6,8,10-pentaen-3-one.
| Compound Name | (4E,6E,8E,10E)-octadeca-1,4,6,8,10-pentaen-3-one |
|---|---|
| PubChem CID | 20847728 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | (4E,6E,8E,10E)-octadeca-1,4,6,8,10-pentaen-3-one |
| SMILES | C=CC(=O)/C=C/C=C/C=C/C=C/CCCCCCC |
| InChI | InChI=1S/C18H26O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)4-2/h4,10-17H,2-3,5-9H2,1H3/b11-10+,13-12+,15-14+,17-16+ |
| InChIKey | PZIHJKHZUYYXJT-SSVNFBSYSA-N |
| XLogP | 5.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|