C19H26O — CID 90034448
nonadeca-1,3,5,7,10,12-hexaen-9-one (PubChem CID 90034448) has the molecular formula C19H26O and a molecular weight of 270.42 g/mol. Its IUPAC name is nonadeca-1,3,5,7,10,12-hexaen-9-one.
| Compound Name | nonadeca-1,3,5,7,10,12-hexaen-9-one |
|---|---|
| PubChem CID | 90034448 |
| Molecular Formula | C19H26O |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | nonadeca-1,3,5,7,10,12-hexaen-9-one |
| SMILES | C=CC=CC=CC=CC(=O)C=CC=CCCCCCC |
| InChI | InChI=1S/C19H26O/c1-3-5-7-9-11-12-14-16-18-19(20)17-15-13-10-8-6-4-2/h4,6,8,10,12-18H,2-3,5,7,9,11H2,1H3 |
| InChIKey | RZQNTOQABIQNDW-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|