C33H50O2 — CID 176646403
14-oxotritriaconta-3,5,10,12,20,22,24-heptaenal (PubChem CID 176646403) has the molecular formula C33H50O2 and a molecular weight of 478.76 g/mol. Its IUPAC name is 14-oxotritriaconta-3,5,10,12,20,22,24-heptaenal.
| Compound Name | 14-oxotritriaconta-3,5,10,12,20,22,24-heptaenal |
|---|---|
| PubChem CID | 176646403 |
| Molecular Formula | C33H50O2 |
| Molecular Weight | 478.76 g/mol |
| Exact Mass | 478.38 |
| IUPAC Name | 14-oxotritriaconta-3,5,10,12,20,22,24-heptaenal |
| SMILES | CCCCCCCCC=CC=CC=CCCCCCC(=O)C=CC=CCCCC=CC=CCC=O |
| InChI | InChI=1S/C33H50O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-15-18-21-24-27-30-33(35)31-28-25-22-19-16-14-17-20-23-26-29-32-34/h9-13,15,17,20,22-23,25-26,28,31-32H,2-8,14,16,18-19,21,24,27,29-30H2,1H3 |
| InChIKey | HIFYENJMTMIWBU-UHFFFAOYSA-N |
| XLogP | 9.91 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.76 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|