C32H48O2 — CID 176646419
14-oxodotriaconta-3,5,10,12,20,22,24-heptaenal (PubChem CID 176646419) has the molecular formula C32H48O2 and a molecular weight of 464.73 g/mol. Its IUPAC name is 14-oxodotriaconta-3,5,10,12,20,22,24-heptaenal.
| Compound Name | 14-oxodotriaconta-3,5,10,12,20,22,24-heptaenal |
|---|---|
| PubChem CID | 176646419 |
| Molecular Formula | C32H48O2 |
| Molecular Weight | 464.73 g/mol |
| Exact Mass | 464.37 |
| IUPAC Name | 14-oxodotriaconta-3,5,10,12,20,22,24-heptaenal |
| SMILES | CCCCCCCC=CC=CC=CCCCCCC(=O)C=CC=CCCCC=CC=CCC=O |
| InChI | InChI=1S/C32H48O2/c1-2-3-4-5-6-7-8-9-10-11-12-14-17-20-23-26-29-32(34)30-27-24-21-18-15-13-16-19-22-25-28-31-33/h8-12,14,16,19,21-22,24-25,27,30-31H,2-7,13,15,17-18,20,23,26,28-29H2,1H3 |
| InChIKey | PDTXARDOEHWDPU-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.73 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|