About heptane;N-methylmethanamine;(E)-2-methyl-3-phenylprop-2-enal
heptane;N-methylmethanamine;(E)-2-methyl-3-phenylprop-2-enal (PubChem CID 142518237) has the molecular formula C19H33NO
and a molecular weight of 291.48 g/mol. Its IUPAC name is heptane;N-methylmethanamine;(E)-2-methyl-3-phenylprop-2-enal.
Molecular Properties
| Compound Name | heptane;N-methylmethanamine;(E)-2-methyl-3-phenylprop-2-enal |
| PubChem CID | 142518237 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | heptane;N-methylmethanamine;(E)-2-methyl-3-phenylprop-2-enal |
| SMILES | C/C(C=O)=C\c1ccccc1.CCCCCCC.CNC |
| InChI | InChI=1S/C10H10O.C7H16.C2H7N/c1-9(8-11)7-10-5-3-2-4-6-10;1-3-5-7-6-4-2;1-3-2/h2-8H,1H3;3-7H2,1-2H3;3H,1-2H3/b9-7+;; |
| InChIKey | ZPBXYFOGKAESRL-OJYIHNBOSA-N |
| XLogP | 5.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze heptane;N-methylmethanamine;(E)-2-methyl-3-phenylprop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptane;N-methylmethanamine;(E)-2-methyl-3-phenylprop-2-enal?
The IUPAC name of heptane;N-methylmethanamine;(E)-2-methyl-3-phenylprop-2-enal (CID 142518237) is heptane;N-methylmethanamine;(E)-2-methyl-3-phenylprop-2-enal.
What is the SMILES notation for heptane;N-methylmethanamine;(E)-2-methyl-3-phenylprop-2-enal?
The canonical SMILES for heptane;N-methylmethanamine;(E)-2-methyl-3-phenylprop-2-enal is C/C(C=O)=C\c1ccccc1.CCCCCCC.CNC.
What is the InChIKey of heptane;N-methylmethanamine;(E)-2-methyl-3-phenylprop-2-enal?
The InChIKey is ZPBXYFOGKAESRL-OJYIHNBOSA-N. The full InChI is InChI=1S/C10H10O.C7H16.C2H7N/c1-9(8-11)7-10-5-3-2-4-6-10;1-3-5-7-6-4-2;1-3-2/h2-8H,1H3;3-7H2,1-2H3;3H,1-2H3/b9-7+;;.
What are the key properties of heptane;N-methylmethanamine;(E)-2-methyl-3-phenylprop-2-enal?
heptane;N-methylmethanamine;(E)-2-methyl-3-phenylprop-2-enal has a molecular weight of 291.48 g/mol, XLogP of 5.10, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for heptane;N-methylmethanamine;(E)-2-methyl-3-phenylprop-2-enal is sourced from PubChem (CID 142518237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).