About (2E)-2-benzylideneoctanal;3-hydroxybutan-2-one
(2E)-2-benzylideneoctanal;3-hydroxybutan-2-one (PubChem CID 174895321) has the molecular formula C19H28O3
and a molecular weight of 304.43 g/mol. Its IUPAC name is (2E)-2-benzylideneoctanal;3-hydroxybutan-2-one.
Molecular Properties
| Compound Name | (2E)-2-benzylideneoctanal;3-hydroxybutan-2-one |
| PubChem CID | 174895321 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (2E)-2-benzylideneoctanal;3-hydroxybutan-2-one |
| SMILES | CC(=O)C(C)O.CCCCCC/C(C=O)=C\c1ccccc1 |
| InChI | InChI=1S/C15H20O.C4H8O2/c1-2-3-4-6-11-15(13-16)12-14-9-7-5-8-10-14;1-3(5)4(2)6/h5,7-10,12-13H,2-4,6,11H2,1H3;3,5H,1-2H3/b15-12+; |
| InChIKey | UWBVYBBGACSRAT-JRUHLWALSA-N |
| XLogP | 4.20 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-benzylideneoctanal;3-hydroxybutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-benzylideneoctanal;3-hydroxybutan-2-one?
The IUPAC name of (2E)-2-benzylideneoctanal;3-hydroxybutan-2-one (CID 174895321) is (2E)-2-benzylideneoctanal;3-hydroxybutan-2-one.
What is the SMILES notation for (2E)-2-benzylideneoctanal;3-hydroxybutan-2-one?
The canonical SMILES for (2E)-2-benzylideneoctanal;3-hydroxybutan-2-one is CC(=O)C(C)O.CCCCCC/C(C=O)=C\c1ccccc1.
What is the InChIKey of (2E)-2-benzylideneoctanal;3-hydroxybutan-2-one?
The InChIKey is UWBVYBBGACSRAT-JRUHLWALSA-N. The full InChI is InChI=1S/C15H20O.C4H8O2/c1-2-3-4-6-11-15(13-16)12-14-9-7-5-8-10-14;1-3(5)4(2)6/h5,7-10,12-13H,2-4,6,11H2,1H3;3,5H,1-2H3/b15-12+;.
What are the key properties of (2E)-2-benzylideneoctanal;3-hydroxybutan-2-one?
(2E)-2-benzylideneoctanal;3-hydroxybutan-2-one has a molecular weight of 304.43 g/mol, XLogP of 4.20, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-benzylideneoctanal;3-hydroxybutan-2-one is sourced from PubChem (CID 174895321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).