C21H32O3 — CID 22851218
(4Z)-4-benzylidene-3-hydroxy-2-methyl-2-propyldecanoic acid (PubChem CID 22851218) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is (4Z)-4-benzylidene-3-hydroxy-2-methyl-2-propyldecanoic acid.
| Compound Name | (4Z)-4-benzylidene-3-hydroxy-2-methyl-2-propyldecanoic acid |
|---|---|
| PubChem CID | 22851218 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | (4Z)-4-benzylidene-3-hydroxy-2-methyl-2-propyldecanoic acid |
| SMILES | CCCCCC/C(=C/c1ccccc1)C(O)C(C)(CCC)C(=O)O |
| InChI | InChI=1S/C21H32O3/c1-4-6-7-11-14-18(16-17-12-9-8-10-13-17)19(22)21(3,15-5-2)20(23)24/h8-10,12-13,16,19,22H,4-7,11,14-15H2,1-3H3,(H,23,24)/b18-16- |
| InChIKey | URPXKCMZAOLRAR-VLGSPTGOSA-N |
| XLogP | 5.29 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|