C14H19NO — CID 5356023
(NZ)-N-[(2E)-2-benzylideneheptylidene]hydroxylamine (PubChem CID 5356023) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is (NZ)-N-[(2E)-2-benzylideneheptylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(2E)-2-benzylideneheptylidene]hydroxylamine |
|---|---|
| PubChem CID | 5356023 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | (NZ)-N-[(2E)-2-benzylideneheptylidene]hydroxylamine |
| SMILES | CCCCCC(/C=N\O)=C\c1ccccc1 |
| InChI | InChI=1S/C14H19NO/c1-2-3-5-10-14(12-15-16)11-13-8-6-4-7-9-13/h4,6-9,11-12,16H,2-3,5,10H2,1H3/b14-11+,15-12- |
| InChIKey | QWDRVWBLCXTVJB-ADBGAXBCSA-N |
| XLogP | 4.11 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|