C21H24N2O — CID 136678687
2-[(E)-[(E)-[(2Z)-2-benzylideneheptylidene]hydrazinylidene]methyl]phenol (PubChem CID 136678687) has the molecular formula C21H24N2O and a molecular weight of 320.44 g/mol. Its IUPAC name is 2-[(E)-[(E)-[(2Z)-2-benzylideneheptylidene]hydrazinylidene]methyl]phenol.
| Compound Name | 2-[(E)-[(E)-[(2Z)-2-benzylideneheptylidene]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 136678687 |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 2-[(E)-[(E)-[(2Z)-2-benzylideneheptylidene]hydrazinylidene]methyl]phenol |
| SMILES | CCCCCC(=C/c1ccccc1)/C=N/N=C/c1ccccc1O |
| InChI | InChI=1S/C21H24N2O/c1-2-3-5-12-19(15-18-10-6-4-7-11-18)16-22-23-17-20-13-8-9-14-21(20)24/h4,6-11,13-17,24H,2-3,5,12H2,1H3/b19-15-,22-16+,23-17+ |
| InChIKey | SPQAJJPMANNQQH-CMZMPKHNSA-N |
| XLogP | 5.46 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|