C19H19N — CID 143914074
N-[(1E,3Z,5Z)-4-methyl-6-phenylhexa-1,3,5-trienyl]aniline (PubChem CID 143914074) has the molecular formula C19H19N and a molecular weight of 261.37 g/mol. Its IUPAC name is N-[(1E,3Z,5Z)-4-methyl-6-phenylhexa-1,3,5-trienyl]aniline.
| Compound Name | N-[(1E,3Z,5Z)-4-methyl-6-phenylhexa-1,3,5-trienyl]aniline |
|---|---|
| PubChem CID | 143914074 |
| Molecular Formula | C19H19N |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | N-[(1E,3Z,5Z)-4-methyl-6-phenylhexa-1,3,5-trienyl]aniline |
| SMILES | CC(/C=C\c1ccccc1)=C/C=C/Nc1ccccc1 |
| InChI | InChI=1S/C19H19N/c1-17(14-15-18-10-4-2-5-11-18)9-8-16-20-19-12-6-3-7-13-19/h2-16,20H,1H3/b15-14-,16-8+,17-9- |
| InChIKey | DRXFAVWCPSPYCH-ZWCOEUIWSA-N |
| XLogP | 5.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|