C18H19ClN2 — CID 75086588
N,N'-diphenylhexa-1,3,5-triene-1,6-diamine;hydrochloride (PubChem CID 75086588) has the molecular formula C18H19ClN2 and a molecular weight of 298.82 g/mol. Its IUPAC name is N,N'-diphenylhexa-1,3,5-triene-1,6-diamine;hydrochloride.
| Compound Name | N,N'-diphenylhexa-1,3,5-triene-1,6-diamine;hydrochloride |
|---|---|
| PubChem CID | 75086588 |
| Molecular Formula | C18H19ClN2 |
| Molecular Weight | 298.82 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | N,N'-diphenylhexa-1,3,5-triene-1,6-diamine;hydrochloride |
| SMILES | C(=CC=CNc1ccccc1)C=CNc1ccccc1.Cl |
| InChI | InChI=1S/C18H18N2.ClH/c1(9-15-19-17-11-5-3-6-12-17)2-10-16-20-18-13-7-4-8-14-18;/h1-16,19-20H;1H |
| InChIKey | FRULOHGXRHFGQT-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.82 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|