C14H11N3O — CID 4140224
2-(5-anilino-2-hydroxypenta-2,4-dienylidene)propanedinitrile (PubChem CID 4140224) has the molecular formula C14H11N3O and a molecular weight of 237.26 g/mol. Its IUPAC name is 2-(5-anilino-2-hydroxypenta-2,4-dienylidene)propanedinitrile.
| Compound Name | 2-(5-anilino-2-hydroxypenta-2,4-dienylidene)propanedinitrile |
|---|---|
| PubChem CID | 4140224 |
| Molecular Formula | C14H11N3O |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 2-(5-anilino-2-hydroxypenta-2,4-dienylidene)propanedinitrile |
| SMILES | N#CC(C#N)=CC(O)=CC=CNc1ccccc1 |
| InChI | InChI=1S/C14H11N3O/c15-10-12(11-16)9-14(18)7-4-8-17-13-5-2-1-3-6-13/h1-9,17-18H |
| InChIKey | IRGGPNUXSSJANH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 79.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|