C18H18ClN3O — CID 139802092
5-anilino-2-(phenyliminomethyl)penta-2,4-dienamide;hydrochloride (PubChem CID 139802092) has the molecular formula C18H18ClN3O and a molecular weight of 327.82 g/mol. Its IUPAC name is 5-anilino-2-(phenyliminomethyl)penta-2,4-dienamide;hydrochloride.
| Compound Name | 5-anilino-2-(phenyliminomethyl)penta-2,4-dienamide;hydrochloride |
|---|---|
| PubChem CID | 139802092 |
| Molecular Formula | C18H18ClN3O |
| Molecular Weight | 327.82 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 5-anilino-2-(phenyliminomethyl)penta-2,4-dienamide;hydrochloride |
| SMILES | Cl.NC(=O)C(=CC=CNc1ccccc1)/C=N/c1ccccc1 |
| InChI | InChI=1S/C18H17N3O.ClH/c19-18(22)15(14-21-17-11-5-2-6-12-17)8-7-13-20-16-9-3-1-4-10-16;/h1-14,20H,(H2,19,22);1H/b13-7?,15-8?,21-14+; |
| InChIKey | OQINWDIGJQJPLC-PBAXNPEBSA-N |
| XLogP | 3.85 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.82 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|