C22H21BrN2O6 — CID 173038596
4-[[6-carboxy-4-[(4-carboxyphenyl)iminomethyl]hexa-1,3-dienyl]amino]benzoic acid;hydrobromide (PubChem CID 173038596) has the molecular formula C22H21BrN2O6 and a molecular weight of 489.32 g/mol. Its IUPAC name is 4-[[6-carboxy-4-[(4-carboxyphenyl)iminomethyl]hexa-1,3-dienyl]amino]benzoic acid;hydrobromide.
| Compound Name | 4-[[6-carboxy-4-[(4-carboxyphenyl)iminomethyl]hexa-1,3-dienyl]amino]benzoic acid;hydrobromide |
|---|---|
| PubChem CID | 173038596 |
| Molecular Formula | C22H21BrN2O6 |
| Molecular Weight | 489.32 g/mol |
| Exact Mass | 488.06 |
| IUPAC Name | 4-[[6-carboxy-4-[(4-carboxyphenyl)iminomethyl]hexa-1,3-dienyl]amino]benzoic acid;hydrobromide |
| SMILES | Br.O=C(O)CCC(=CC=CNc1ccc(C(=O)O)cc1)/C=N/c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C22H20N2O6.BrH/c25-20(26)12-3-15(14-24-19-10-6-17(7-11-19)22(29)30)2-1-13-23-18-8-4-16(5-9-18)21(27)28;/h1-2,4-11,13-14,23H,3,12H2,(H,25,26)(H,27,28)(H,29,30);1H/b13-1?,15-2?,24-14+; |
| InChIKey | JXIMHSJDSQIUQX-UFQRPLILSA-N |
| XLogP | 4.78 |
| TPSA | 136.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.32 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|