C11H8F3NO3 — CID 131874294
4-[[(Z)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]benzoic acid (PubChem CID 131874294) has the molecular formula C11H8F3NO3 and a molecular weight of 259.18 g/mol. Its IUPAC name is 4-[[(Z)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]benzoic acid.
| Compound Name | 4-[[(Z)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]benzoic acid |
|---|---|
| PubChem CID | 131874294 |
| Molecular Formula | C11H8F3NO3 |
| Molecular Weight | 259.18 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 4-[[(Z)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(N/C=C\C(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H8F3NO3/c12-11(13,14)9(16)5-6-15-8-3-1-7(2-4-8)10(17)18/h1-6,15H,(H,17,18)/b6-5- |
| InChIKey | ZXTLVLBNCNYTKK-WAYWQWQTSA-N |
| XLogP | 2.44 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.18 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|