C13H10F7NO2 — CID 101356177
(Z)-4,4,5,5,6,6,6-heptafluoro-1-(4-methoxyanilino)hex-1-en-3-one (PubChem CID 101356177) has the molecular formula C13H10F7NO2 and a molecular weight of 345.21 g/mol. Its IUPAC name is (Z)-4,4,5,5,6,6,6-heptafluoro-1-(4-methoxyanilino)hex-1-en-3-one.
| Compound Name | (Z)-4,4,5,5,6,6,6-heptafluoro-1-(4-methoxyanilino)hex-1-en-3-one |
|---|---|
| PubChem CID | 101356177 |
| Molecular Formula | C13H10F7NO2 |
| Molecular Weight | 345.21 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | (Z)-4,4,5,5,6,6,6-heptafluoro-1-(4-methoxyanilino)hex-1-en-3-one |
| SMILES | COc1ccc(N/C=C\C(=O)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H10F7NO2/c1-23-9-4-2-8(3-5-9)21-7-6-10(22)11(14,15)12(16,17)13(18,19)20/h2-7,21H,1H3/b7-6- |
| InChIKey | YJZZRJZUIUNUCD-SREVYHEPSA-N |
| XLogP | 4.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.21 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|