C18H21NO4 — CID 657715
2-[3-(4-methoxyanilino)prop-2-enoyl]-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 657715) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is 2-[3-(4-methoxyanilino)prop-2-enoyl]-5,5-dimethylcyclohexane-1,3-dione.
| Compound Name | 2-[3-(4-methoxyanilino)prop-2-enoyl]-5,5-dimethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 657715 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 2-[3-(4-methoxyanilino)prop-2-enoyl]-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | COc1ccc(NC=CC(=O)C2C(=O)CC(C)(C)CC2=O)cc1 |
| InChI | InChI=1S/C18H21NO4/c1-18(2)10-15(21)17(16(22)11-18)14(20)8-9-19-12-4-6-13(23-3)7-5-12/h4-9,17,19H,10-11H2,1-3H3 |
| InChIKey | ONYURAQVODVJSU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|