C18H23NO3 — CID 7358649
2-[2-(4-methoxyphenyl)ethyliminomethyl]-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 7358649) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-[2-(4-methoxyphenyl)ethyliminomethyl]-5,5-dimethylcyclohexane-1,3-dione.
| Compound Name | 2-[2-(4-methoxyphenyl)ethyliminomethyl]-5,5-dimethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 7358649 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 2-[2-(4-methoxyphenyl)ethyliminomethyl]-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | COc1ccc(CC/N=C/C2C(=O)CC(C)(C)CC2=O)cc1 |
| InChI | InChI=1S/C18H23NO3/c1-18(2)10-16(20)15(17(21)11-18)12-19-9-8-13-4-6-14(22-3)7-5-13/h4-7,12,15H,8-11H2,1-3H3/b19-12+ |
| InChIKey | GYMVFMVRVJVJTJ-XDHOZWIPSA-N |
| XLogP | 2.88 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|