C21H17F3N4O2S — CID 92542445
(4S)-2-(1,3-benzothiazol-2-yl)-4-[2-(4-methoxyphenyl)ethyliminomethyl]-5-(trifluoromethyl)-4H-pyrazol-3-one (PubChem CID 92542445) has the molecular formula C21H17F3N4O2S and a molecular weight of 446.45 g/mol. Its IUPAC name is (4S)-2-(1,3-benzothiazol-2-yl)-4-[2-(4-methoxyphenyl)ethyliminomethyl]-5-(trifluoromethyl)-4H-pyrazol-3-one.
| Compound Name | (4S)-2-(1,3-benzothiazol-2-yl)-4-[2-(4-methoxyphenyl)ethyliminomethyl]-5-(trifluoromethyl)-4H-pyrazol-3-one |
|---|---|
| PubChem CID | 92542445 |
| Molecular Formula | C21H17F3N4O2S |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | (4S)-2-(1,3-benzothiazol-2-yl)-4-[2-(4-methoxyphenyl)ethyliminomethyl]-5-(trifluoromethyl)-4H-pyrazol-3-one |
| SMILES | COc1ccc(CC/N=C/[C@@H]2C(=O)N(c3nc4ccccc4s3)N=C2C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H17F3N4O2S/c1-30-14-8-6-13(7-9-14)10-11-25-12-15-18(21(22,23)24)27-28(19(15)29)20-26-16-4-2-3-5-17(16)31-20/h2-9,12,15H,10-11H2,1H3/b25-12+/t15-/m0/s1 |
| InChIKey | UDJSZKQBWLGJJR-FCUAXUHVSA-N |
| XLogP | 4.50 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|