C24H26N4OS — CID 9498532
2-(1,3-benzothiazol-2-yl)-4-(heptyliminomethyl)-5-phenyl-4H-pyrazol-3-one (PubChem CID 9498532) has the molecular formula C24H26N4OS and a molecular weight of 418.57 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-4-(heptyliminomethyl)-5-phenyl-4H-pyrazol-3-one.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-4-(heptyliminomethyl)-5-phenyl-4H-pyrazol-3-one |
|---|---|
| PubChem CID | 9498532 |
| Molecular Formula | C24H26N4OS |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-4-(heptyliminomethyl)-5-phenyl-4H-pyrazol-3-one |
| SMILES | CCCCCCC/N=C/C1C(=O)N(c2nc3ccccc3s2)N=C1c1ccccc1 |
| InChI | InChI=1S/C24H26N4OS/c1-2-3-4-5-11-16-25-17-19-22(18-12-7-6-8-13-18)27-28(23(19)29)24-26-20-14-9-10-15-21(20)30-24/h6-10,12-15,17,19H,2-5,11,16H2,1H3/b25-17+ |
| InChIKey | XBZQVRNDDFVZKK-KOEQRZSOSA-N |
| XLogP | 5.70 |
| TPSA | 57.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|