C23H18N4O2S — CID 7366158
2-(1,3-benzothiazol-2-yl)-4-[N-(furan-2-ylmethyl)-C-methylcarbonimidoyl]-5-phenyl-4H-pyrazol-3-one (PubChem CID 7366158) has the molecular formula C23H18N4O2S and a molecular weight of 414.49 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-4-[N-(furan-2-ylmethyl)-C-methylcarbonimidoyl]-5-phenyl-4H-pyrazol-3-one.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-4-[N-(furan-2-ylmethyl)-C-methylcarbonimidoyl]-5-phenyl-4H-pyrazol-3-one |
|---|---|
| PubChem CID | 7366158 |
| Molecular Formula | C23H18N4O2S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-4-[N-(furan-2-ylmethyl)-C-methylcarbonimidoyl]-5-phenyl-4H-pyrazol-3-one |
| SMILES | C/C(=N\Cc1ccco1)C1C(=O)N(c2nc3ccccc3s2)N=C1c1ccccc1 |
| InChI | InChI=1S/C23H18N4O2S/c1-15(24-14-17-10-7-13-29-17)20-21(16-8-3-2-4-9-16)26-27(22(20)28)23-25-18-11-5-6-12-19(18)30-23/h2-13,20H,14H2,1H3/b24-15+ |
| InChIKey | CQHJBRDNIYQMFU-BUVRLJJBSA-N |
| XLogP | 4.92 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|