C20H18N4O3S — CID 11896251
(4S)-2-(1,3-benzothiazol-2-yl)-4-(2-hydroxyethyliminomethyl)-5-(4-methoxyphenyl)-4H-pyrazol-3-one (PubChem CID 11896251) has the molecular formula C20H18N4O3S and a molecular weight of 394.46 g/mol. Its IUPAC name is (4S)-2-(1,3-benzothiazol-2-yl)-4-(2-hydroxyethyliminomethyl)-5-(4-methoxyphenyl)-4H-pyrazol-3-one.
| Compound Name | (4S)-2-(1,3-benzothiazol-2-yl)-4-(2-hydroxyethyliminomethyl)-5-(4-methoxyphenyl)-4H-pyrazol-3-one |
|---|---|
| PubChem CID | 11896251 |
| Molecular Formula | C20H18N4O3S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | (4S)-2-(1,3-benzothiazol-2-yl)-4-(2-hydroxyethyliminomethyl)-5-(4-methoxyphenyl)-4H-pyrazol-3-one |
| SMILES | COc1ccc(C2=NN(c3nc4ccccc4s3)C(=O)[C@H]2/C=N/CCO)cc1 |
| InChI | InChI=1S/C20H18N4O3S/c1-27-14-8-6-13(7-9-14)18-15(12-21-10-11-25)19(26)24(23-18)20-22-16-4-2-3-5-17(16)28-20/h2-9,12,15,25H,10-11H2,1H3/b21-12+/t15-/m0/s1 |
| InChIKey | ALBLTQVRYYZZNF-NGZBARDMSA-N |
| XLogP | 2.74 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|