C22H24N5OS+ — CID 7358638
3-[[1-(1,3-benzothiazol-2-yl)-5-oxo-3-phenyl-4H-pyrazol-4-yl]methylideneamino]propyl-dimethylazanium (PubChem CID 7358638) has the molecular formula C22H24N5OS+ and a molecular weight of 406.54 g/mol. Its IUPAC name is 3-[[1-(1,3-benzothiazol-2-yl)-5-oxo-3-phenyl-4H-pyrazol-4-yl]methylideneamino]propyl-dimethylazanium.
| Compound Name | 3-[[1-(1,3-benzothiazol-2-yl)-5-oxo-3-phenyl-4H-pyrazol-4-yl]methylideneamino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 7358638 |
| Molecular Formula | C22H24N5OS+ |
| Molecular Weight | 406.54 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 3-[[1-(1,3-benzothiazol-2-yl)-5-oxo-3-phenyl-4H-pyrazol-4-yl]methylideneamino]propyl-dimethylazanium |
| SMILES | C[NH+](C)CCC/N=C/C1C(=O)N(c2nc3ccccc3s2)N=C1c1ccccc1 |
| InChI | InChI=1S/C22H23N5OS/c1-26(2)14-8-13-23-15-17-20(16-9-4-3-5-10-16)25-27(21(17)28)22-24-18-11-6-7-12-19(18)29-22/h3-7,9-12,15,17H,8,13-14H2,1-2H3/p+1/b23-15+ |
| InChIKey | ZWHPXNKNZCNNEH-HZHRSRAPSA-O |
| XLogP | 2.27 |
| TPSA | 62.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.54 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|