C23H18ClN3O — CID 11921188
(4R)-4-[(4-chlorophenyl)methyliminomethyl]-2,5-diphenyl-4H-pyrazol-3-one (PubChem CID 11921188) has the molecular formula C23H18ClN3O and a molecular weight of 387.87 g/mol. Its IUPAC name is (4R)-4-[(4-chlorophenyl)methyliminomethyl]-2,5-diphenyl-4H-pyrazol-3-one.
| Compound Name | (4R)-4-[(4-chlorophenyl)methyliminomethyl]-2,5-diphenyl-4H-pyrazol-3-one |
|---|---|
| PubChem CID | 11921188 |
| Molecular Formula | C23H18ClN3O |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | (4R)-4-[(4-chlorophenyl)methyliminomethyl]-2,5-diphenyl-4H-pyrazol-3-one |
| SMILES | O=C1[C@H](/C=N/Cc2ccc(Cl)cc2)C(c2ccccc2)=NN1c1ccccc1 |
| InChI | InChI=1S/C23H18ClN3O/c24-19-13-11-17(12-14-19)15-25-16-21-22(18-7-3-1-4-8-18)26-27(23(21)28)20-9-5-2-6-10-20/h1-14,16,21H,15H2/b25-16+/t21-/m1/s1 |
| InChIKey | VWLATUQMBMXTBA-NSRYLYFRSA-N |
| XLogP | 4.98 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|