C14H14ClN3O3 — CID 7595937
5-[(4-chlorophenyl)methyliminomethyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 7595937) has the molecular formula C14H14ClN3O3 and a molecular weight of 307.74 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)methyliminomethyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(4-chlorophenyl)methyliminomethyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7595937 |
| Molecular Formula | C14H14ClN3O3 |
| Molecular Weight | 307.74 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 5-[(4-chlorophenyl)methyliminomethyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CN1C(=O)C(/C=N/Cc2ccc(Cl)cc2)C(=O)N(C)C1=O |
| InChI | InChI=1S/C14H14ClN3O3/c1-17-12(19)11(13(20)18(2)14(17)21)8-16-7-9-3-5-10(15)6-4-9/h3-6,8,11H,7H2,1-2H3/b16-8+ |
| InChIKey | HJWTXJXFFIVYEP-LZYBPNLTSA-N |
| XLogP | 1.58 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.74 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|